C21H37NO4Si — CID 90475554
methyl 3-[(5E)-5-methoxyimino-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopenten-1-yl]propanoate (PubChem CID 90475554) has the molecular formula C21H37NO4Si and a molecular weight of 395.62 g/mol. Its IUPAC name is methyl 3-[(5E)-5-methoxyimino-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopenten-1-yl]propanoate.
| Compound Name | methyl 3-[(5E)-5-methoxyimino-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopenten-1-yl]propanoate |
|---|---|
| PubChem CID | 90475554 |
| Molecular Formula | C21H37NO4Si |
| Molecular Weight | 395.62 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | methyl 3-[(5E)-5-methoxyimino-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopenten-1-yl]propanoate |
| SMILES | CCCCC[C@@H](/C=C/C1=C(CCC(=O)OC)/C(=N/OC)CC1)O[Si](C)(C)C |
| InChI | InChI=1S/C21H37NO4Si/c1-7-8-9-10-18(26-27(4,5)6)13-11-17-12-15-20(22-25-3)19(17)14-16-21(23)24-2/h11,13,18H,7-10,12,14-16H2,1-6H3/b13-11+,22-20+/t18-/m0/s1 |
| InChIKey | QLZYEYVOOHYNHB-ZXDWXFKMSA-N |
| XLogP | 5.39 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.62 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|