C21H44O6Si2 — CID 135015607
methyl (E,5S,6R,7S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-6,8-dihydroxyoct-2-enoate (PubChem CID 135015607) has the molecular formula C21H44O6Si2 and a molecular weight of 448.75 g/mol. Its IUPAC name is methyl (E,5S,6R,7S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-6,8-dihydroxyoct-2-enoate.
| Compound Name | methyl (E,5S,6R,7S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-6,8-dihydroxyoct-2-enoate |
|---|---|
| PubChem CID | 135015607 |
| Molecular Formula | C21H44O6Si2 |
| Molecular Weight | 448.75 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | methyl (E,5S,6R,7S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-6,8-dihydroxyoct-2-enoate |
| SMILES | COC(=O)/C=C/C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H44O6Si2/c1-20(2,3)28(8,9)26-16(13-12-14-18(23)25-7)19(24)17(15-22)27-29(10,11)21(4,5)6/h12,14,16-17,19,22,24H,13,15H2,1-11H3/b14-12+/t16-,17-,19+/m0/s1 |
| InChIKey | ZEJNMFNZLFFIGU-NMJWJYOZSA-N |
| XLogP | 4.24 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.75 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|