C15H30O4Si — CID 11358559
ethyl (E,5S)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxyhept-2-enoate (PubChem CID 11358559) has the molecular formula C15H30O4Si and a molecular weight of 302.49 g/mol. Its IUPAC name is ethyl (E,5S)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxyhept-2-enoate.
| Compound Name | ethyl (E,5S)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxyhept-2-enoate |
|---|---|
| PubChem CID | 11358559 |
| Molecular Formula | C15H30O4Si |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | ethyl (E,5S)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxyhept-2-enoate |
| SMILES | CCOC(=O)/C=C/C[C@H](O)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H30O4Si/c1-7-18-14(17)10-8-9-13(16)11-12-19-20(5,6)15(2,3)4/h8,10,13,16H,7,9,11-12H2,1-6H3/b10-8+/t13-/m0/s1 |
| InChIKey | KFKHMXNHJWVYSJ-FROQITRMSA-N |
| XLogP | 3.27 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|