C27H48O4Si — CID 10961605
methyl (Z)-7-[(1R,2S,5S)-2-[(E)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-hydroxycyclopent-3-en-1-yl]hept-5-enoate (PubChem CID 10961605) has the molecular formula C27H48O4Si and a molecular weight of 464.76 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2S,5S)-2-[(E)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-hydroxycyclopent-3-en-1-yl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2S,5S)-2-[(E)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-hydroxycyclopent-3-en-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 10961605 |
| Molecular Formula | C27H48O4Si |
| Molecular Weight | 464.76 g/mol |
| Exact Mass | 464.33 |
| IUPAC Name | methyl (Z)-7-[(1R,2S,5S)-2-[(E)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-hydroxycyclopent-3-en-1-yl]hept-5-enoate |
| SMILES | CCCCCC(/C=C/[C@@H]1C=C[C@H](O)[C@@H]1C/C=C\CCCC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H48O4Si/c1-8-9-12-15-23(31-32(6,7)27(2,3)4)20-18-22-19-21-25(28)24(22)16-13-10-11-14-17-26(29)30-5/h10,13,18-25,28H,8-9,11-12,14-17H2,1-7H3/b13-10-,20-18+/t22-,23?,24-,25+/m1/s1 |
| InChIKey | QSLMPXBXDSOVOV-XZBFKMJCSA-N |
| XLogP | 6.97 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.76 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|