C18H36O4Si — CID 46192662
(E,3R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-10-methylundec-4-enoic acid (PubChem CID 46192662) has the molecular formula C18H36O4Si and a molecular weight of 344.57 g/mol. Its IUPAC name is (E,3R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-10-methylundec-4-enoic acid.
| Compound Name | (E,3R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-10-methylundec-4-enoic acid |
|---|---|
| PubChem CID | 46192662 |
| Molecular Formula | C18H36O4Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (E,3R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-10-methylundec-4-enoic acid |
| SMILES | CC(C)CCC[C@H](/C=C/[C@H](O)CC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36O4Si/c1-14(2)9-8-10-16(12-11-15(19)13-17(20)21)22-23(6,7)18(3,4)5/h11-12,14-16,19H,8-10,13H2,1-7H3,(H,20,21)/b12-11+/t15-,16+/m0/s1 |
| InChIKey | DKDIWQMSQKGMMG-HMUVLFPJSA-N |
| XLogP | 4.59 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|