C32H68O6Si4 — CID 91751605
trimethylsilyl (5Z,8R,9S,10E,12S)-8-[(1S)-1,3-bis(trimethylsilyloxy)propyl]-9-hydroxy-12-trimethylsilyloxyheptadeca-5,10-dienoate (PubChem CID 91751605) has the molecular formula C32H68O6Si4 and a molecular weight of 661.23 g/mol. Its IUPAC name is trimethylsilyl (5Z,8R,9S,10E,12S)-8-[(1S)-1,3-bis(trimethylsilyloxy)propyl]-9-hydroxy-12-trimethylsilyloxyheptadeca-5,10-dienoate.
| Compound Name | trimethylsilyl (5Z,8R,9S,10E,12S)-8-[(1S)-1,3-bis(trimethylsilyloxy)propyl]-9-hydroxy-12-trimethylsilyloxyheptadeca-5,10-dienoate |
|---|---|
| PubChem CID | 91751605 |
| Molecular Formula | C32H68O6Si4 |
| Molecular Weight | 661.23 g/mol |
| Exact Mass | 660.41 |
| IUPAC Name | trimethylsilyl (5Z,8R,9S,10E,12S)-8-[(1S)-1,3-bis(trimethylsilyloxy)propyl]-9-hydroxy-12-trimethylsilyloxyheptadeca-5,10-dienoate |
| SMILES | CCCCC[C@@H](/C=C/[C@H](O)[C@@H](C/C=C\CCCC(=O)O[Si](C)(C)C)[C@H](CCO[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C32H68O6Si4/c1-14-15-18-21-28(36-40(5,6)7)24-25-30(33)29(22-19-16-17-20-23-32(34)38-42(11,12)13)31(37-41(8,9)10)26-27-35-39(2,3)4/h16,19,24-25,28-31,33H,14-15,17-18,20-23,26-27H2,1-13H3/b19-16-,25-24+/t28-,29+,30-,31-/m0/s1 |
| InChIKey | VTFFYSQOZOUVSJ-SDLXQLBKSA-N |
| XLogP | 9.28 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.23 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|