C18H34O4Si — CID 134837095
(3S,4E,6E,11R)-11-[tert-butyl(dimethyl)silyl]oxy-3-hydroxydodeca-4,6-dienoic acid (PubChem CID 134837095) has the molecular formula C18H34O4Si and a molecular weight of 342.55 g/mol. Its IUPAC name is (3S,4E,6E,11R)-11-[tert-butyl(dimethyl)silyl]oxy-3-hydroxydodeca-4,6-dienoic acid.
| Compound Name | (3S,4E,6E,11R)-11-[tert-butyl(dimethyl)silyl]oxy-3-hydroxydodeca-4,6-dienoic acid |
|---|---|
| PubChem CID | 134837095 |
| Molecular Formula | C18H34O4Si |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (3S,4E,6E,11R)-11-[tert-butyl(dimethyl)silyl]oxy-3-hydroxydodeca-4,6-dienoic acid |
| SMILES | C[C@H](CCC/C=C/C=C/[C@@H](O)CC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H34O4Si/c1-15(22-23(5,6)18(2,3)4)12-10-8-7-9-11-13-16(19)14-17(20)21/h7,9,11,13,15-16,19H,8,10,12,14H2,1-6H3,(H,20,21)/b9-7+,13-11+/t15-,16-/m1/s1 |
| InChIKey | IBHOPMHEYXXGLP-PKQXYMDBSA-N |
| XLogP | 4.51 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|