C18H38O4Si2 — CID 45276075
2-trimethylsilylethyl (E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxyhept-4-enoate (PubChem CID 45276075) has the molecular formula C18H38O4Si2 and a molecular weight of 374.67 g/mol. Its IUPAC name is 2-trimethylsilylethyl (E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxyhept-4-enoate.
| Compound Name | 2-trimethylsilylethyl (E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxyhept-4-enoate |
|---|---|
| PubChem CID | 45276075 |
| Molecular Formula | C18H38O4Si2 |
| Molecular Weight | 374.67 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | 2-trimethylsilylethyl (E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxyhept-4-enoate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](/C=C/CCO)CC(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C18H38O4Si2/c1-18(2,3)24(7,8)22-16(11-9-10-12-19)15-17(20)21-13-14-23(4,5)6/h9,11,16,19H,10,12-15H2,1-8H3/b11-9+/t16-/m1/s1 |
| InChIKey | UIHAPZCRCXYTKF-PXUDHTSWSA-N |
| XLogP | 4.59 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.67 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|