C34H60O4Si2 — CID 139252516
(4Z,7R,8E,10E,12Z,14S,16Z,19Z)-7,14-bis[[tert-butyl(dimethyl)silyl]oxy]docosa-4,8,10,12,16,19-hexaenoic acid (PubChem CID 139252516) has the molecular formula C34H60O4Si2 and a molecular weight of 589.02 g/mol. Its IUPAC name is (4Z,7R,8E,10E,12Z,14S,16Z,19Z)-7,14-bis[[tert-butyl(dimethyl)silyl]oxy]docosa-4,8,10,12,16,19-hexaenoic acid.
| Compound Name | (4Z,7R,8E,10E,12Z,14S,16Z,19Z)-7,14-bis[[tert-butyl(dimethyl)silyl]oxy]docosa-4,8,10,12,16,19-hexaenoic acid |
|---|---|
| PubChem CID | 139252516 |
| Molecular Formula | C34H60O4Si2 |
| Molecular Weight | 589.02 g/mol |
| Exact Mass | 588.40 |
| IUPAC Name | (4Z,7R,8E,10E,12Z,14S,16Z,19Z)-7,14-bis[[tert-butyl(dimethyl)silyl]oxy]docosa-4,8,10,12,16,19-hexaenoic acid |
| SMILES | CC/C=C\C/C=C\C[C@@H](/C=C\C=C\C=C\[C@@H](C/C=C\CCC(=O)O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H60O4Si2/c1-12-13-14-15-16-20-25-30(37-39(8,9)33(2,3)4)26-21-17-18-22-27-31(28-23-19-24-29-32(35)36)38-40(10,11)34(5,6)7/h13-14,16-23,26-27,30-31H,12,15,24-25,28-29H2,1-11H3,(H,35,36)/b14-13-,18-17+,20-16-,23-19-,26-21-,27-22+/t30-,31-/m0/s1 |
| InChIKey | KCARMTLCKAJLTP-HCUZFPPVSA-N |
| XLogP | 10.55 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.02 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|