C35H62O4Si2 — CID 146162328
methyl (4S,5E,7Z,10Z,13Z,15E,17S,19Z)-4,17-bis[[tert-butyl(dimethyl)silyl]oxy]docosa-5,7,10,13,15,19-hexaenoate (PubChem CID 146162328) has the molecular formula C35H62O4Si2 and a molecular weight of 603.05 g/mol. Its IUPAC name is methyl (4S,5E,7Z,10Z,13Z,15E,17S,19Z)-4,17-bis[[tert-butyl(dimethyl)silyl]oxy]docosa-5,7,10,13,15,19-hexaenoate.
| Compound Name | methyl (4S,5E,7Z,10Z,13Z,15E,17S,19Z)-4,17-bis[[tert-butyl(dimethyl)silyl]oxy]docosa-5,7,10,13,15,19-hexaenoate |
|---|---|
| PubChem CID | 146162328 |
| Molecular Formula | C35H62O4Si2 |
| Molecular Weight | 603.05 g/mol |
| Exact Mass | 602.42 |
| IUPAC Name | methyl (4S,5E,7Z,10Z,13Z,15E,17S,19Z)-4,17-bis[[tert-butyl(dimethyl)silyl]oxy]docosa-5,7,10,13,15,19-hexaenoate |
| SMILES | CC/C=C\C[C@@H](/C=C/C=C\C/C=C\C/C=C\C=C\[C@H](CCC(=O)OC)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H62O4Si2/c1-13-14-23-26-31(38-40(9,10)34(2,3)4)27-24-21-19-17-15-16-18-20-22-25-28-32(29-30-33(36)37-8)39-41(11,12)35(5,6)7/h14-16,19-25,27-28,31-32H,13,17-18,26,29-30H2,1-12H3/b16-15-,21-19-,22-20-,23-14-,27-24+,28-25+/t31-,32+/m0/s1 |
| InChIKey | BWDGECVRJXLEEI-DVVZLPDPSA-N |
| XLogP | 10.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.05 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|