C27H46O3Si — CID 138982538
methyl (5Z,8Z,11Z,14Z,16E,18R)-18-[tert-butyl(dimethyl)silyl]oxyicosa-5,8,11,14,16-pentaenoate (PubChem CID 138982538) has the molecular formula C27H46O3Si and a molecular weight of 446.75 g/mol. Its IUPAC name is methyl (5Z,8Z,11Z,14Z,16E,18R)-18-[tert-butyl(dimethyl)silyl]oxyicosa-5,8,11,14,16-pentaenoate.
| Compound Name | methyl (5Z,8Z,11Z,14Z,16E,18R)-18-[tert-butyl(dimethyl)silyl]oxyicosa-5,8,11,14,16-pentaenoate |
|---|---|
| PubChem CID | 138982538 |
| Molecular Formula | C27H46O3Si |
| Molecular Weight | 446.75 g/mol |
| Exact Mass | 446.32 |
| IUPAC Name | methyl (5Z,8Z,11Z,14Z,16E,18R)-18-[tert-butyl(dimethyl)silyl]oxyicosa-5,8,11,14,16-pentaenoate |
| SMILES | CC[C@H](/C=C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H46O3Si/c1-8-25(30-31(6,7)27(2,3)4)23-21-19-17-15-13-11-9-10-12-14-16-18-20-22-24-26(28)29-5/h10-13,16-19,21,23,25H,8-9,14-15,20,22,24H2,1-7H3/b12-10-,13-11-,18-16-,19-17-,23-21+/t25-/m1/s1 |
| InChIKey | AWZOZKMICHEUMI-OTSLJWRQSA-N |
| XLogP | 8.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.75 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|