C19H36O3Si — CID 11688696
methyl (5E,7Z)-7-tri(propan-2-yl)silyloxynona-5,7-dienoate (PubChem CID 11688696) has the molecular formula C19H36O3Si and a molecular weight of 340.58 g/mol. Its IUPAC name is methyl (5E,7Z)-7-tri(propan-2-yl)silyloxynona-5,7-dienoate.
| Compound Name | methyl (5E,7Z)-7-tri(propan-2-yl)silyloxynona-5,7-dienoate |
|---|---|
| PubChem CID | 11688696 |
| Molecular Formula | C19H36O3Si |
| Molecular Weight | 340.58 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | methyl (5E,7Z)-7-tri(propan-2-yl)silyloxynona-5,7-dienoate |
| SMILES | C/C=C(/C=C/CCCC(=O)OC)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H36O3Si/c1-9-18(13-11-10-12-14-19(20)21-8)22-23(15(2)3,16(4)5)17(6)7/h9,11,13,15-17H,10,12,14H2,1-8H3/b13-11+,18-9- |
| InChIKey | IFBVVXIRBPHXES-UBAKEQHPSA-N |
| XLogP | 5.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.58 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|