C27H38O3Si — CID 138982536
methyl (E,18R)-18-[tert-butyl(dimethyl)silyl]oxyicos-16-en-5,8,11,14-tetraynoate (PubChem CID 138982536) has the molecular formula C27H38O3Si and a molecular weight of 438.68 g/mol. Its IUPAC name is methyl (E,18R)-18-[tert-butyl(dimethyl)silyl]oxyicos-16-en-5,8,11,14-tetraynoate.
| Compound Name | methyl (E,18R)-18-[tert-butyl(dimethyl)silyl]oxyicos-16-en-5,8,11,14-tetraynoate |
|---|---|
| PubChem CID | 138982536 |
| Molecular Formula | C27H38O3Si |
| Molecular Weight | 438.68 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | methyl (E,18R)-18-[tert-butyl(dimethyl)silyl]oxyicos-16-en-5,8,11,14-tetraynoate |
| SMILES | CC[C@H](/C=C/C#CCC#CCC#CCC#CCCCC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H38O3Si/c1-8-25(30-31(6,7)27(2,3)4)23-21-19-17-15-13-11-9-10-12-14-16-18-20-22-24-26(28)29-5/h21,23,25H,8-9,14-15,20,22,24H2,1-7H3/b23-21+/t25-/m1/s1 |
| InChIKey | DUPOQLQNIGNCNL-XTAOWTACSA-N |
| XLogP | 5.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.68 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|