C27H46O3Si — CID 134901302
methyl (5S,6E,11Z,14Z)-5-[tert-butyl(dimethyl)silyl]oxyicosa-6,11,14-trien-8-ynoate (PubChem CID 134901302) has the molecular formula C27H46O3Si and a molecular weight of 446.75 g/mol. Its IUPAC name is methyl (5S,6E,11Z,14Z)-5-[tert-butyl(dimethyl)silyl]oxyicosa-6,11,14-trien-8-ynoate.
| Compound Name | methyl (5S,6E,11Z,14Z)-5-[tert-butyl(dimethyl)silyl]oxyicosa-6,11,14-trien-8-ynoate |
|---|---|
| PubChem CID | 134901302 |
| Molecular Formula | C27H46O3Si |
| Molecular Weight | 446.75 g/mol |
| Exact Mass | 446.32 |
| IUPAC Name | methyl (5S,6E,11Z,14Z)-5-[tert-butyl(dimethyl)silyl]oxyicosa-6,11,14-trien-8-ynoate |
| SMILES | CCCCC/C=C\C/C=C\CC#C/C=C/[C@H](CCCC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H46O3Si/c1-8-9-10-11-12-13-14-15-16-17-18-19-20-22-25(23-21-24-26(28)29-5)30-31(6,7)27(2,3)4/h12-13,15-16,20,22,25H,8-11,14,17,21,23-24H2,1-7H3/b13-12-,16-15-,22-20+/t25-/m1/s1 |
| InChIKey | CGHFFKREUYBYDN-QPFLTXFDSA-N |
| XLogP | 7.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.75 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|