C33H58O4Si2 — CID 134887139
methyl (10E,12S,14Z)-12,20-bis[[tert-butyl(dimethyl)silyl]oxy]icosa-10,14-dien-5,8-diynoate (PubChem CID 134887139) has the molecular formula C33H58O4Si2 and a molecular weight of 575.00 g/mol. Its IUPAC name is methyl (10E,12S,14Z)-12,20-bis[[tert-butyl(dimethyl)silyl]oxy]icosa-10,14-dien-5,8-diynoate.
| Compound Name | methyl (10E,12S,14Z)-12,20-bis[[tert-butyl(dimethyl)silyl]oxy]icosa-10,14-dien-5,8-diynoate |
|---|---|
| PubChem CID | 134887139 |
| Molecular Formula | C33H58O4Si2 |
| Molecular Weight | 575.00 g/mol |
| Exact Mass | 574.39 |
| IUPAC Name | methyl (10E,12S,14Z)-12,20-bis[[tert-butyl(dimethyl)silyl]oxy]icosa-10,14-dien-5,8-diynoate |
| SMILES | COC(=O)CCCC#CCC#C/C=C/[C@H](C/C=C\CCCCCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H58O4Si2/c1-32(2,3)38(8,9)36-29-25-21-17-16-19-23-27-30(37-39(10,11)33(4,5)6)26-22-18-14-12-13-15-20-24-28-31(34)35-7/h19,22-23,26,30H,12,16-17,20-21,24-25,27-29H2,1-11H3/b23-19-,26-22+/t30-/m1/s1 |
| InChIKey | FZAAGTZCFNPGKG-XWNHRJGMSA-N |
| XLogP | 9.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.00 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|