C33H60O4Si2 — CID 134977625
[(E,12S,17S)-12,17-bis[[tert-butyl(dimethyl)silyl]oxy]nonadec-10-en-13,15-diynyl] acetate (PubChem CID 134977625) has the molecular formula C33H60O4Si2 and a molecular weight of 577.01 g/mol. Its IUPAC name is [(E,12S,17S)-12,17-bis[[tert-butyl(dimethyl)silyl]oxy]nonadec-10-en-13,15-diynyl] acetate.
| Compound Name | [(E,12S,17S)-12,17-bis[[tert-butyl(dimethyl)silyl]oxy]nonadec-10-en-13,15-diynyl] acetate |
|---|---|
| PubChem CID | 134977625 |
| Molecular Formula | C33H60O4Si2 |
| Molecular Weight | 577.01 g/mol |
| Exact Mass | 576.40 |
| IUPAC Name | [(E,12S,17S)-12,17-bis[[tert-butyl(dimethyl)silyl]oxy]nonadec-10-en-13,15-diynyl] acetate |
| SMILES | CC[C@@H](C#CC#C[C@H](/C=C/CCCCCCCCCOC(C)=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H60O4Si2/c1-13-30(36-38(9,10)32(3,4)5)25-22-23-27-31(37-39(11,12)33(6,7)8)26-21-19-17-15-14-16-18-20-24-28-35-29(2)34/h21,26,30-31H,13-20,24,28H2,1-12H3/b26-21+/t30-,31-/m0/s1 |
| InChIKey | MKGBRRDJMJUYRB-ZUDJGKGYSA-N |
| XLogP | 9.42 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.01 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|