C43H80O5Si3 — CID 138976516
ethyl (7S,8R,9E,11E,15E,17S,20Z)-7,8,17-tris[[tert-butyl(dimethyl)silyl]oxy]tricosa-9,11,15,20-tetraen-13-ynoate (PubChem CID 138976516) has the molecular formula C43H80O5Si3 and a molecular weight of 761.37 g/mol. Its IUPAC name is ethyl (7S,8R,9E,11E,15E,17S,20Z)-7,8,17-tris[[tert-butyl(dimethyl)silyl]oxy]tricosa-9,11,15,20-tetraen-13-ynoate.
| Compound Name | ethyl (7S,8R,9E,11E,15E,17S,20Z)-7,8,17-tris[[tert-butyl(dimethyl)silyl]oxy]tricosa-9,11,15,20-tetraen-13-ynoate |
|---|---|
| PubChem CID | 138976516 |
| Molecular Formula | C43H80O5Si3 |
| Molecular Weight | 761.37 g/mol |
| Exact Mass | 760.53 |
| IUPAC Name | ethyl (7S,8R,9E,11E,15E,17S,20Z)-7,8,17-tris[[tert-butyl(dimethyl)silyl]oxy]tricosa-9,11,15,20-tetraen-13-ynoate |
| SMILES | CC/C=C\CC[C@@H](/C=C/C#C/C=C/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CCCCCC(=O)OCC)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C43H80O5Si3/c1-18-20-21-27-32-37(46-49(12,13)41(3,4)5)33-28-24-22-23-25-29-34-38(47-50(14,15)42(6,7)8)39(48-51(16,17)43(9,10)11)35-30-26-31-36-40(44)45-19-2/h20-21,23,25,28-29,33-34,37-39H,18-19,26-27,30-32,35-36H2,1-17H3/b21-20-,25-23+,33-28+,34-29+/t37-,38+,39-/m0/s1 |
| InChIKey | PHXYXFWZYUJPCB-BRCFLGGXSA-N |
| XLogP | 13.09 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.37 |
| LogP ≤ 5 | 13.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|