C33H62O4Si2 — CID 134887195
methyl (5S,6R,7E,9E,11Z,14Z)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]icosa-7,9,11,14-tetraenoate (PubChem CID 134887195) has the molecular formula C33H62O4Si2 and a molecular weight of 579.03 g/mol. Its IUPAC name is methyl (5S,6R,7E,9E,11Z,14Z)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]icosa-7,9,11,14-tetraenoate.
| Compound Name | methyl (5S,6R,7E,9E,11Z,14Z)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]icosa-7,9,11,14-tetraenoate |
|---|---|
| PubChem CID | 134887195 |
| Molecular Formula | C33H62O4Si2 |
| Molecular Weight | 579.03 g/mol |
| Exact Mass | 578.42 |
| IUPAC Name | methyl (5S,6R,7E,9E,11Z,14Z)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]icosa-7,9,11,14-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\C=C\C=C\[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CCCC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H62O4Si2/c1-13-14-15-16-17-18-19-20-21-22-23-24-26-29(36-38(9,10)32(2,3)4)30(27-25-28-31(34)35-8)37-39(11,12)33(5,6)7/h17-18,20-24,26,29-30H,13-16,19,25,27-28H2,1-12H3/b18-17-,21-20-,23-22+,26-24+/t29-,30+/m1/s1 |
| InChIKey | SDSRTMDNKWUWEN-BNNKODFTSA-N |
| XLogP | 10.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.03 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|