C40H76O5Si3 — CID 134853217
methyl (E,5S,6R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-8-[6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyhexyl]cyclohepta-1,3,5-trien-1-yl]oct-7-enoate (PubChem CID 134853217) has the molecular formula C40H76O5Si3 and a molecular weight of 721.30 g/mol. Its IUPAC name is methyl (E,5S,6R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-8-[6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyhexyl]cyclohepta-1,3,5-trien-1-yl]oct-7-enoate.
| Compound Name | methyl (E,5S,6R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-8-[6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyhexyl]cyclohepta-1,3,5-trien-1-yl]oct-7-enoate |
|---|---|
| PubChem CID | 134853217 |
| Molecular Formula | C40H76O5Si3 |
| Molecular Weight | 721.30 g/mol |
| Exact Mass | 720.50 |
| IUPAC Name | methyl (E,5S,6R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-8-[6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyhexyl]cyclohepta-1,3,5-trien-1-yl]oct-7-enoate |
| SMILES | CCCCC[C@@H](O[Si](C)(C)C(C)(C)C)C1=CC=CC=C(/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CCCC(=O)OC)O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C40H76O5Si3/c1-18-19-20-26-34(43-46(12,13)38(2,3)4)33-25-22-21-24-32(31-33)29-30-36(45-48(16,17)40(8,9)10)35(27-23-28-37(41)42-11)44-47(14,15)39(5,6)7/h21-22,24-25,29-30,34-36H,18-20,23,26-28,31H2,1-17H3/b30-29+/t34-,35+,36-/m1/s1 |
| InChIKey | VPOCKRYFBRFICJ-KHMQTVPLSA-N |
| XLogP | 12.45 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.30 |
| LogP ≤ 5 | 12.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|