C39H74O5Si3 — CID 134882752
methyl (5S,6E,10E,12E,14S,15S)-5,14,15-tris[[tert-butyl(dimethyl)silyl]oxy]icosa-6,10,12-trien-8-ynoate (PubChem CID 134882752) has the molecular formula C39H74O5Si3 and a molecular weight of 707.27 g/mol. Its IUPAC name is methyl (5S,6E,10E,12E,14S,15S)-5,14,15-tris[[tert-butyl(dimethyl)silyl]oxy]icosa-6,10,12-trien-8-ynoate.
| Compound Name | methyl (5S,6E,10E,12E,14S,15S)-5,14,15-tris[[tert-butyl(dimethyl)silyl]oxy]icosa-6,10,12-trien-8-ynoate |
|---|---|
| PubChem CID | 134882752 |
| Molecular Formula | C39H74O5Si3 |
| Molecular Weight | 707.27 g/mol |
| Exact Mass | 706.48 |
| IUPAC Name | methyl (5S,6E,10E,12E,14S,15S)-5,14,15-tris[[tert-butyl(dimethyl)silyl]oxy]icosa-6,10,12-trien-8-ynoate |
| SMILES | CCCCC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](/C=C/C=C/C#C/C=C/[C@H](CCCC(=O)OC)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C39H74O5Si3/c1-18-19-24-30-34(43-46(14,15)38(5,6)7)35(44-47(16,17)39(8,9)10)31-26-23-21-20-22-25-28-33(29-27-32-36(40)41-11)42-45(12,13)37(2,3)4/h21,23,25-26,28,31,33-35H,18-19,24,27,29-30,32H2,1-17H3/b23-21+,28-25+,31-26+/t33-,34+,35+/m1/s1 |
| InChIKey | VJNNKCOSENUHBL-BBUQWLJNSA-N |
| XLogP | 11.75 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.27 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|