C37H70O5Si3 — CID 134887210
methyl (E,5S,10S)-5,10,18-tris[[tert-butyl(dimethyl)silyl]oxy]octadec-8-en-6,12-diynoate (PubChem CID 134887210) has the molecular formula C37H70O5Si3 and a molecular weight of 679.22 g/mol. Its IUPAC name is methyl (E,5S,10S)-5,10,18-tris[[tert-butyl(dimethyl)silyl]oxy]octadec-8-en-6,12-diynoate.
| Compound Name | methyl (E,5S,10S)-5,10,18-tris[[tert-butyl(dimethyl)silyl]oxy]octadec-8-en-6,12-diynoate |
|---|---|
| PubChem CID | 134887210 |
| Molecular Formula | C37H70O5Si3 |
| Molecular Weight | 679.22 g/mol |
| Exact Mass | 678.45 |
| IUPAC Name | methyl (E,5S,10S)-5,10,18-tris[[tert-butyl(dimethyl)silyl]oxy]octadec-8-en-6,12-diynoate |
| SMILES | COC(=O)CCC[C@@H](C#C/C=C/[C@H](CC#CCCCCCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H70O5Si3/c1-35(2,3)43(11,12)40-31-24-20-18-17-19-21-26-32(41-44(13,14)36(4,5)6)27-22-23-28-33(29-25-30-34(38)39-10)42-45(15,16)37(7,8)9/h22,27,32-33H,17-18,20,24-26,29-31H2,1-16H3/b27-22+/t32-,33+/m0/s1 |
| InChIKey | MMZOFHOBROGSFZ-JRPTZSNBSA-N |
| XLogP | 10.65 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.22 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|