C33H54O4Si2 — CID 146162788
methyl (5S,6E,16E,18R)-5,18-bis[[tert-butyl(dimethyl)silyl]oxy]icosa-6,16-dien-8,11,14-triynoate (PubChem CID 146162788) has the molecular formula C33H54O4Si2 and a molecular weight of 570.96 g/mol. Its IUPAC name is methyl (5S,6E,16E,18R)-5,18-bis[[tert-butyl(dimethyl)silyl]oxy]icosa-6,16-dien-8,11,14-triynoate.
| Compound Name | methyl (5S,6E,16E,18R)-5,18-bis[[tert-butyl(dimethyl)silyl]oxy]icosa-6,16-dien-8,11,14-triynoate |
|---|---|
| PubChem CID | 146162788 |
| Molecular Formula | C33H54O4Si2 |
| Molecular Weight | 570.96 g/mol |
| Exact Mass | 570.36 |
| IUPAC Name | methyl (5S,6E,16E,18R)-5,18-bis[[tert-butyl(dimethyl)silyl]oxy]icosa-6,16-dien-8,11,14-triynoate |
| SMILES | CC[C@H](/C=C/C#CCC#CCC#C/C=C/[C@H](CCCC(=O)OC)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H54O4Si2/c1-13-29(36-38(9,10)32(2,3)4)25-22-20-18-16-14-15-17-19-21-23-26-30(27-24-28-31(34)35-8)37-39(11,12)33(5,6)7/h22-23,25-26,29-30H,13,16-17,24,27-28H2,1-12H3/b25-22+,26-23+/t29-,30-/m1/s1 |
| InChIKey | CTGADZDSGPMBMW-BWJANFCESA-N |
| XLogP | 8.42 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.96 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|