C33H58O4Si2 — CID 134853218
(6S)-6-[(E,1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-[6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyhexyl]cyclohepta-1,3,5-trien-1-yl]prop-2-enyl]oxan-2-one (PubChem CID 134853218) has the molecular formula C33H58O4Si2 and a molecular weight of 575.00 g/mol. Its IUPAC name is (6S)-6-[(E,1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-[6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyhexyl]cyclohepta-1,3,5-trien-1-yl]prop-2-enyl]oxan-2-one.
| Compound Name | (6S)-6-[(E,1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-[6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyhexyl]cyclohepta-1,3,5-trien-1-yl]prop-2-enyl]oxan-2-one |
|---|---|
| PubChem CID | 134853218 |
| Molecular Formula | C33H58O4Si2 |
| Molecular Weight | 575.00 g/mol |
| Exact Mass | 574.39 |
| IUPAC Name | (6S)-6-[(E,1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-[6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyhexyl]cyclohepta-1,3,5-trien-1-yl]prop-2-enyl]oxan-2-one |
| SMILES | CCCCC[C@@H](O[Si](C)(C)C(C)(C)C)C1=CC=CC=C(/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2CCCC(=O)O2)C1 |
| InChI | InChI=1S/C33H58O4Si2/c1-12-13-14-20-28(36-38(8,9)32(2,3)4)27-19-16-15-18-26(25-27)23-24-30(29-21-17-22-31(34)35-29)37-39(10,11)33(5,6)7/h15-16,18-19,23-24,28-30H,12-14,17,20-22,25H2,1-11H3/b24-23+/t28-,29+,30-/m1/s1 |
| InChIKey | SSDBPJSQTBQRCT-TVLUFSLZSA-N |
| XLogP | 9.81 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.00 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|