C27H46O4Si — CID 10895863
methyl 4-[(2S,3S)-3-[(1E,3E,5Z,8Z)-13-[tert-butyl(dimethyl)silyl]oxytetradeca-1,3,5,8-tetraenyl]oxiran-2-yl]butanoate (PubChem CID 10895863) has the molecular formula C27H46O4Si and a molecular weight of 462.75 g/mol. Its IUPAC name is methyl 4-[(2S,3S)-3-[(1E,3E,5Z,8Z)-13-[tert-butyl(dimethyl)silyl]oxytetradeca-1,3,5,8-tetraenyl]oxiran-2-yl]butanoate.
| Compound Name | methyl 4-[(2S,3S)-3-[(1E,3E,5Z,8Z)-13-[tert-butyl(dimethyl)silyl]oxytetradeca-1,3,5,8-tetraenyl]oxiran-2-yl]butanoate |
|---|---|
| PubChem CID | 10895863 |
| Molecular Formula | C27H46O4Si |
| Molecular Weight | 462.75 g/mol |
| Exact Mass | 462.32 |
| IUPAC Name | methyl 4-[(2S,3S)-3-[(1E,3E,5Z,8Z)-13-[tert-butyl(dimethyl)silyl]oxytetradeca-1,3,5,8-tetraenyl]oxiran-2-yl]butanoate |
| SMILES | COC(=O)CCC[C@@H]1O[C@H]1/C=C/C=C/C=C\C/C=C\CCCC(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H46O4Si/c1-23(31-32(6,7)27(2,3)4)19-16-14-12-10-8-9-11-13-15-17-20-24-25(30-24)21-18-22-26(28)29-5/h9-13,15,17,20,23-25H,8,14,16,18-19,21-22H2,1-7H3/b11-9-,12-10-,15-13+,20-17+/t23?,24-,25-/m0/s1 |
| InChIKey | ACDZAJRYAQKQRF-ZYYDDYBDSA-N |
| XLogP | 7.29 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.75 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|