C17H32O4Si — CID 72948036
methyl (3S,5R,6E)-3-[tert-butyl(dimethyl)silyl]oxy-5-methoxynona-6,8-dienoate (PubChem CID 72948036) has the molecular formula C17H32O4Si and a molecular weight of 328.53 g/mol. Its IUPAC name is methyl (3S,5R,6E)-3-[tert-butyl(dimethyl)silyl]oxy-5-methoxynona-6,8-dienoate.
| Compound Name | methyl (3S,5R,6E)-3-[tert-butyl(dimethyl)silyl]oxy-5-methoxynona-6,8-dienoate |
|---|---|
| PubChem CID | 72948036 |
| Molecular Formula | C17H32O4Si |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | methyl (3S,5R,6E)-3-[tert-butyl(dimethyl)silyl]oxy-5-methoxynona-6,8-dienoate |
| SMILES | C=C/C=C/[C@@H](C[C@@H](CC(=O)OC)O[Si](C)(C)C(C)(C)C)OC |
| InChI | InChI=1S/C17H32O4Si/c1-9-10-11-14(19-5)12-15(13-16(18)20-6)21-22(7,8)17(2,3)4/h9-11,14-15H,1,12-13H2,2-8H3/b11-10+/t14-,15-/m0/s1 |
| InChIKey | IQZGTEQYPGYPPK-BWLFODOESA-N |
| XLogP | 4.09 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|