C21H38O5Si — CID 135014823
ethyl 3-oxo-4-[(2S,6R)-2-[tri(propan-2-yl)silyloxymethyl]-3,6-dihydro-2H-pyran-6-yl]butanoate (PubChem CID 135014823) has the molecular formula C21H38O5Si and a molecular weight of 398.62 g/mol. Its IUPAC name is ethyl 3-oxo-4-[(2S,6R)-2-[tri(propan-2-yl)silyloxymethyl]-3,6-dihydro-2H-pyran-6-yl]butanoate.
| Compound Name | ethyl 3-oxo-4-[(2S,6R)-2-[tri(propan-2-yl)silyloxymethyl]-3,6-dihydro-2H-pyran-6-yl]butanoate |
|---|---|
| PubChem CID | 135014823 |
| Molecular Formula | C21H38O5Si |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | ethyl 3-oxo-4-[(2S,6R)-2-[tri(propan-2-yl)silyloxymethyl]-3,6-dihydro-2H-pyran-6-yl]butanoate |
| SMILES | CCOC(=O)CC(=O)C[C@@H]1C=CC[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)O1 |
| InChI | InChI=1S/C21H38O5Si/c1-8-24-21(23)13-18(22)12-19-10-9-11-20(26-19)14-25-27(15(2)3,16(4)5)17(6)7/h9-10,15-17,19-20H,8,11-14H2,1-7H3/t19-,20-/m0/s1 |
| InChIKey | YRFAWWYGKVDTRO-PMACEKPBSA-N |
| XLogP | 4.80 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|