C20H36O4Si — CID 11036003
tert-butyl (6E,8E)-5-[tert-butyl(dimethyl)silyl]oxy-3-oxodeca-6,8-dienoate (PubChem CID 11036003) has the molecular formula C20H36O4Si and a molecular weight of 368.59 g/mol. Its IUPAC name is tert-butyl (6E,8E)-5-[tert-butyl(dimethyl)silyl]oxy-3-oxodeca-6,8-dienoate.
| Compound Name | tert-butyl (6E,8E)-5-[tert-butyl(dimethyl)silyl]oxy-3-oxodeca-6,8-dienoate |
|---|---|
| PubChem CID | 11036003 |
| Molecular Formula | C20H36O4Si |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | tert-butyl (6E,8E)-5-[tert-butyl(dimethyl)silyl]oxy-3-oxodeca-6,8-dienoate |
| SMILES | C/C=C/C=C/C(CC(=O)CC(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H36O4Si/c1-10-11-12-13-17(24-25(8,9)20(5,6)7)14-16(21)15-18(22)23-19(2,3)4/h10-13,17H,14-15H2,1-9H3/b11-10+,13-12+ |
| InChIKey | AQARSWDRLUVYBY-AQASXUMVSA-N |
| XLogP | 5.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|