C24H44O3Si — CID 91696943
methyl (6E,8Z,14Z)-5-trimethylsilyloxyicosa-6,8,14-trienoate (PubChem CID 91696943) has the molecular formula C24H44O3Si and a molecular weight of 408.70 g/mol. Its IUPAC name is methyl (6E,8Z,14Z)-5-trimethylsilyloxyicosa-6,8,14-trienoate.
| Compound Name | methyl (6E,8Z,14Z)-5-trimethylsilyloxyicosa-6,8,14-trienoate |
|---|---|
| PubChem CID | 91696943 |
| Molecular Formula | C24H44O3Si |
| Molecular Weight | 408.70 g/mol |
| Exact Mass | 408.31 |
| IUPAC Name | methyl (6E,8Z,14Z)-5-trimethylsilyloxyicosa-6,8,14-trienoate |
| SMILES | CCCCC/C=C\CCCC/C=C\C=C\C(CCCC(=O)OC)O[Si](C)(C)C |
| InChI | InChI=1S/C24H44O3Si/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-20-23(27-28(3,4)5)21-19-22-24(25)26-2/h10-11,16-18,20,23H,6-9,12-15,19,21-22H2,1-5H3/b11-10-,17-16-,20-18+ |
| InChIKey | PABDCKKLPHNAMS-XYAYNOJRSA-N |
| XLogP | 7.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.70 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|