C27H50O4Si2 — CID 91733271
methyl (6E,8Z,10E,14Z)-5,12-bis(trimethylsilyloxy)icosa-6,8,10,14-tetraenoate (PubChem CID 91733271) has the molecular formula C27H50O4Si2 and a molecular weight of 494.87 g/mol. Its IUPAC name is methyl (6E,8Z,10E,14Z)-5,12-bis(trimethylsilyloxy)icosa-6,8,10,14-tetraenoate.
| Compound Name | methyl (6E,8Z,10E,14Z)-5,12-bis(trimethylsilyloxy)icosa-6,8,10,14-tetraenoate |
|---|---|
| PubChem CID | 91733271 |
| Molecular Formula | C27H50O4Si2 |
| Molecular Weight | 494.87 g/mol |
| Exact Mass | 494.32 |
| IUPAC Name | methyl (6E,8Z,10E,14Z)-5,12-bis(trimethylsilyloxy)icosa-6,8,10,14-tetraenoate |
| SMILES | CCCCC/C=C\CC(/C=C/C=C\C=C\C(CCCC(=O)OC)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C27H50O4Si2/c1-9-10-11-12-13-16-20-25(30-32(3,4)5)21-17-14-15-18-22-26(31-33(6,7)8)23-19-24-27(28)29-2/h13-18,21-22,25-26H,9-12,19-20,23-24H2,1-8H3/b15-14-,16-13-,21-17+,22-18+ |
| InChIKey | RUBZORHXVDDTDQ-PNUJOXLUSA-N |
| XLogP | 7.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.87 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|