C23H44O7Si — CID 102231343
ethyl (3S,5R,6E,8E,11S,12R)-3-[tert-butyl(dimethyl)silyl]oxy-12,13-dihydroxy-5,11-dimethoxytrideca-6,8-dienoate (PubChem CID 102231343) has the molecular formula C23H44O7Si and a molecular weight of 460.68 g/mol. Its IUPAC name is ethyl (3S,5R,6E,8E,11S,12R)-3-[tert-butyl(dimethyl)silyl]oxy-12,13-dihydroxy-5,11-dimethoxytrideca-6,8-dienoate.
| Compound Name | ethyl (3S,5R,6E,8E,11S,12R)-3-[tert-butyl(dimethyl)silyl]oxy-12,13-dihydroxy-5,11-dimethoxytrideca-6,8-dienoate |
|---|---|
| PubChem CID | 102231343 |
| Molecular Formula | C23H44O7Si |
| Molecular Weight | 460.68 g/mol |
| Exact Mass | 460.29 |
| IUPAC Name | ethyl (3S,5R,6E,8E,11S,12R)-3-[tert-butyl(dimethyl)silyl]oxy-12,13-dihydroxy-5,11-dimethoxytrideca-6,8-dienoate |
| SMILES | CCOC(=O)C[C@H](C[C@H](/C=C/C=C/C[C@H](OC)[C@H](O)CO)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H44O7Si/c1-9-29-22(26)16-19(30-31(7,8)23(2,3)4)15-18(27-5)13-11-10-12-14-21(28-6)20(25)17-24/h10-13,18-21,24-25H,9,14-17H2,1-8H3/b12-10+,13-11+/t18-,19-,20+,21-/m0/s1 |
| InChIKey | UQFSOYDCKOHFPM-SGKADCFOSA-N |
| XLogP | 3.61 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.68 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|