C20H38O4Si — CID 10904745
tert-butyl (3S,5R,6E,8E)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxydeca-6,8-dienoate (PubChem CID 10904745) has the molecular formula C20H38O4Si and a molecular weight of 370.61 g/mol. Its IUPAC name is tert-butyl (3S,5R,6E,8E)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxydeca-6,8-dienoate.
| Compound Name | tert-butyl (3S,5R,6E,8E)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxydeca-6,8-dienoate |
|---|---|
| PubChem CID | 10904745 |
| Molecular Formula | C20H38O4Si |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | tert-butyl (3S,5R,6E,8E)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxydeca-6,8-dienoate |
| SMILES | C/C=C/C=C/[C@@H](C[C@H](O)CC(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38O4Si/c1-10-11-12-13-17(24-25(8,9)20(5,6)7)14-16(21)15-18(22)23-19(2,3)4/h10-13,16-17,21H,14-15H2,1-9H3/b11-10+,13-12+/t16-,17-/m0/s1 |
| InChIKey | CXBFMLNFLXZJJW-KXBMRAGMSA-N |
| XLogP | 4.99 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|