C25H50O4Si — CID 10003495
ethyl (E,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyheptadec-6-enoate (PubChem CID 10003495) has the molecular formula C25H50O4Si and a molecular weight of 442.76 g/mol. Its IUPAC name is ethyl (E,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyheptadec-6-enoate.
| Compound Name | ethyl (E,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyheptadec-6-enoate |
|---|---|
| PubChem CID | 10003495 |
| Molecular Formula | C25H50O4Si |
| Molecular Weight | 442.76 g/mol |
| Exact Mass | 442.35 |
| IUPAC Name | ethyl (E,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyheptadec-6-enoate |
| SMILES | CCCCCCCCCC/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CCC(=O)OCC |
| InChI | InChI=1S/C25H50O4Si/c1-8-10-11-12-13-14-15-16-17-18-19-23(29-30(6,7)25(3,4)5)22(26)20-21-24(27)28-9-2/h18-19,22-23,26H,8-17,20-21H2,1-7H3/b19-18+/t22-,23-/m1/s1 |
| InChIKey | BUGNYASXWDBRNG-KHZUJUORSA-N |
| XLogP | 7.17 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.76 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|