C23H48O5Si2 — CID 24770703
[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl] (4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxyhexanoate (PubChem CID 24770703) has the molecular formula C23H48O5Si2 and a molecular weight of 460.80 g/mol. Its IUPAC name is [(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl] (4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxyhexanoate.
| Compound Name | [(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl] (4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxyhexanoate |
|---|---|
| PubChem CID | 24770703 |
| Molecular Formula | C23H48O5Si2 |
| Molecular Weight | 460.80 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | [(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl] (4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxyhexanoate |
| SMILES | C=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)OC(=O)CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)O |
| InChI | InChI=1S/C23H48O5Si2/c1-14-19(27-29(10,11)22(4,5)6)18(3)26-21(25)16-15-20(17(2)24)28-30(12,13)23(7,8)9/h14,17-20,24H,1,15-16H2,2-13H3/t17-,18-,19+,20+/m0/s1 |
| InChIKey | PIUIPOFHWXHZAJ-VNTMZGSJSA-N |
| XLogP | 6.05 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.80 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|