C19H39IO4Si2 — CID 10791919
(E,4S,5R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-iodohept-6-enoic acid (PubChem CID 10791919) has the molecular formula C19H39IO4Si2 and a molecular weight of 514.59 g/mol. Its IUPAC name is (E,4S,5R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-iodohept-6-enoic acid.
| Compound Name | (E,4S,5R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-iodohept-6-enoic acid |
|---|---|
| PubChem CID | 10791919 |
| Molecular Formula | C19H39IO4Si2 |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | (E,4S,5R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-iodohept-6-enoic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CCC(=O)O)[C@@H](/C=C/I)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H39IO4Si2/c1-18(2,3)25(7,8)23-15(11-12-17(21)22)16(13-14-20)24-26(9,10)19(4,5)6/h13-16H,11-12H2,1-10H3,(H,21,22)/b14-13+/t15-,16+/m0/s1 |
| InChIKey | KYBVIGIBICIDBP-UGQPTUNDSA-N |
| XLogP | 6.58 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|