C18H37IO4Si2 — CID 10864017
(E,3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-iodohex-5-enoic acid (PubChem CID 10864017) has the molecular formula C18H37IO4Si2 and a molecular weight of 500.57 g/mol. Its IUPAC name is (E,3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-iodohex-5-enoic acid.
| Compound Name | (E,3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-iodohex-5-enoic acid |
|---|---|
| PubChem CID | 10864017 |
| Molecular Formula | C18H37IO4Si2 |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | (E,3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-iodohex-5-enoic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](/C=C/I)[C@H](CC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H37IO4Si2/c1-17(2,3)24(7,8)22-14(11-12-19)15(13-16(20)21)23-25(9,10)18(4,5)6/h11-12,14-15H,13H2,1-10H3,(H,20,21)/b12-11+/t14-,15-/m0/s1 |
| InChIKey | BIIXAXWXWJDKRK-NOQIOLJMSA-N |
| XLogP | 6.19 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|