C19H37IO4Si — CID 66552943
[(2R)-5-hydroxypentan-2-yl] (E,3S)-5-iodo-3-tri(propan-2-yl)silyloxypent-4-enoate (PubChem CID 66552943) has the molecular formula C19H37IO4Si and a molecular weight of 484.49 g/mol. Its IUPAC name is [(2R)-5-hydroxypentan-2-yl] (E,3S)-5-iodo-3-tri(propan-2-yl)silyloxypent-4-enoate.
| Compound Name | [(2R)-5-hydroxypentan-2-yl] (E,3S)-5-iodo-3-tri(propan-2-yl)silyloxypent-4-enoate |
|---|---|
| PubChem CID | 66552943 |
| Molecular Formula | C19H37IO4Si |
| Molecular Weight | 484.49 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | [(2R)-5-hydroxypentan-2-yl] (E,3S)-5-iodo-3-tri(propan-2-yl)silyloxypent-4-enoate |
| SMILES | CC(C)[Si](O[C@H](/C=C/I)CC(=O)O[C@H](C)CCCO)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H37IO4Si/c1-14(2)25(15(3)4,16(5)6)24-18(10-11-20)13-19(22)23-17(7)9-8-12-21/h10-11,14-18,21H,8-9,12-13H2,1-7H3/b11-10+/t17-,18-/m1/s1 |
| InChIKey | BGVMZWJNJVPNBB-NDZBKKTDSA-N |
| XLogP | 5.59 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.49 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|