C16H33IOSi — CID 90772091
[(3S)-7-iodohept-4-en-3-yl]oxy-tri(propan-2-yl)silane (PubChem CID 90772091) has the molecular formula C16H33IOSi and a molecular weight of 396.43 g/mol. Its IUPAC name is [(3S)-7-iodohept-4-en-3-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(3S)-7-iodohept-4-en-3-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 90772091 |
| Molecular Formula | C16H33IOSi |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | [(3S)-7-iodohept-4-en-3-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CC[C@@H](C=CCCI)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C16H33IOSi/c1-8-16(11-9-10-12-17)18-19(13(2)3,14(4)5)15(6)7/h9,11,13-16H,8,10,12H2,1-7H3/t16-/m0/s1 |
| InChIKey | UGBZXYIQWDPTQX-INIZCTEOSA-N |
| XLogP | 6.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|