C25H50OSi — CID 10927345
[(7E,10E)-hexadeca-7,10-dien-6-yl]oxy-tri(propan-2-yl)silane (PubChem CID 10927345) has the molecular formula C25H50OSi and a molecular weight of 394.76 g/mol. Its IUPAC name is [(7E,10E)-hexadeca-7,10-dien-6-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(7E,10E)-hexadeca-7,10-dien-6-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 10927345 |
| Molecular Formula | C25H50OSi |
| Molecular Weight | 394.76 g/mol |
| Exact Mass | 394.36 |
| IUPAC Name | [(7E,10E)-hexadeca-7,10-dien-6-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CCCCC/C=C/C/C=C/C(CCCCC)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H50OSi/c1-9-11-13-14-15-16-17-19-21-25(20-18-12-10-2)26-27(22(3)4,23(5)6)24(7)8/h15-16,19,21-25H,9-14,17-18,20H2,1-8H3/b16-15+,21-19+ |
| InChIKey | SCMLKJUSGPCZLZ-MCRDVGPXSA-N |
| XLogP | 9.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.76 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|