C38H68O4 — CID 138183743
(11Z,14Z)-10-[(Z)-octadec-9-enoyl]oxyicosa-11,14-dienoic acid (PubChem CID 138183743) has the molecular formula C38H68O4 and a molecular weight of 588.96 g/mol. Its IUPAC name is (11Z,14Z)-10-[(Z)-octadec-9-enoyl]oxyicosa-11,14-dienoic acid.
| Compound Name | (11Z,14Z)-10-[(Z)-octadec-9-enoyl]oxyicosa-11,14-dienoic acid |
|---|---|
| PubChem CID | 138183743 |
| Molecular Formula | C38H68O4 |
| Molecular Weight | 588.96 g/mol |
| Exact Mass | 588.51 |
| IUPAC Name | (11Z,14Z)-10-[(Z)-octadec-9-enoyl]oxyicosa-11,14-dienoic acid |
| SMILES | CCCCC/C=C\C/C=C\C(CCCCCCCCC(=O)O)OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C38H68O4/c1-3-5-7-9-11-13-14-15-16-17-18-19-21-27-31-35-38(41)42-36(32-28-24-20-12-10-8-6-4-2)33-29-25-22-23-26-30-34-37(39)40/h12,15-16,20,28,32,36H,3-11,13-14,17-19,21-27,29-31,33-35H2,1-2H3,(H,39,40)/b16-15-,20-12-,32-28- |
| InChIKey | JCSIXDDZIPRNLF-OXKNCCIJSA-N |
| XLogP | 12.22 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.96 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|