C44H74O4 — CID 138117892
(10Z,13Z,16Z)-9-[(10Z,13Z,16Z)-docosa-10,13,16-trienoyl]oxydocosa-10,13,16-trienoic acid (PubChem CID 138117892) has the molecular formula C44H74O4 and a molecular weight of 667.07 g/mol. Its IUPAC name is (10Z,13Z,16Z)-9-[(10Z,13Z,16Z)-docosa-10,13,16-trienoyl]oxydocosa-10,13,16-trienoic acid.
| Compound Name | (10Z,13Z,16Z)-9-[(10Z,13Z,16Z)-docosa-10,13,16-trienoyl]oxydocosa-10,13,16-trienoic acid |
|---|---|
| PubChem CID | 138117892 |
| Molecular Formula | C44H74O4 |
| Molecular Weight | 667.07 g/mol |
| Exact Mass | 666.56 |
| IUPAC Name | (10Z,13Z,16Z)-9-[(10Z,13Z,16Z)-docosa-10,13,16-trienoyl]oxydocosa-10,13,16-trienoic acid |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCCCCCC(=O)OC(/C=C\C/C=C\C/C=C\CCCCC)CCCCCCCC(=O)O |
| InChI | InChI=1S/C44H74O4/c1-3-5-7-9-11-13-15-16-17-18-19-20-21-22-24-26-28-33-37-41-44(47)48-42(39-35-31-29-32-36-40-43(45)46)38-34-30-27-25-23-14-12-10-8-6-4-2/h11-14,16-17,19-20,25,27,34,38,42H,3-10,15,18,21-24,26,28-33,35-37,39-41H2,1-2H3,(H,45,46)/b13-11-,14-12-,17-16-,20-19-,27-25-,38-34- |
| InChIKey | AGODJRPAXGVOPV-VPLULBEKSA-N |
| XLogP | 13.89 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.07 |
| LogP ≤ 5 | 13.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|