C8H16O4 — CID 159836227
2,6-dihydroperoxyoct-4-ene (PubChem CID 159836227) has the molecular formula C8H16O4 and a molecular weight of 176.21 g/mol. Its IUPAC name is 2,6-dihydroperoxyoct-4-ene.
| Compound Name | 2,6-dihydroperoxyoct-4-ene |
|---|---|
| PubChem CID | 159836227 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 2,6-dihydroperoxyoct-4-ene |
| SMILES | CCC(C=CCC(C)OO)OO |
| InChI | InChI=1S/C8H16O4/c1-3-8(12-10)6-4-5-7(2)11-9/h4,6-10H,3,5H2,1-2H3 |
| InChIKey | YQJZYQUMBDPOCU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|