C18H29O6- — CID 122391293
(9S,10E,12Z,14E,16S)-9,16-dihydroperoxyoctadeca-10,12,14-trienoate (PubChem CID 122391293) has the molecular formula C18H29O6- and a molecular weight of 341.42 g/mol. Its IUPAC name is (9S,10E,12Z,14E,16S)-9,16-dihydroperoxyoctadeca-10,12,14-trienoate.
| Compound Name | (9S,10E,12Z,14E,16S)-9,16-dihydroperoxyoctadeca-10,12,14-trienoate |
|---|---|
| PubChem CID | 122391293 |
| Molecular Formula | C18H29O6- |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | (9S,10E,12Z,14E,16S)-9,16-dihydroperoxyoctadeca-10,12,14-trienoate |
| SMILES | CC[C@@H](/C=C/C=C\C=C\[C@H](CCCCCCCC(=O)[O-])OO)OO |
| InChI | InChI=1S/C18H30O6/c1-2-16(23-21)12-8-6-7-10-14-17(24-22)13-9-4-3-5-11-15-18(19)20/h6-8,10,12,14,16-17,21-22H,2-5,9,11,13,15H2,1H3,(H,19,20)/p-1/b7-6-,12-8+,14-10+/t16-,17-/m0/s1 |
| InChIKey | MFVHQYMRUDEPIO-NYOLHIHQSA-M |
| XLogP | 3.26 |
| TPSA | 99.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|