About butan-2-one;2-hydroperoxybutane
butan-2-one;2-hydroperoxybutane (PubChem CID 162156312) has the molecular formula C8H18O3
and a molecular weight of 162.23 g/mol. Its IUPAC name is butan-2-one;2-hydroperoxybutane.
Molecular Properties
| Compound Name | butan-2-one;2-hydroperoxybutane |
| PubChem CID | 162156312 |
| Molecular Formula | C8H18O3 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.13 |
| IUPAC Name | butan-2-one;2-hydroperoxybutane |
| SMILES | CCC(C)=O.CCC(C)OO |
| InChI | InChI=1S/C4H10O2.C4H8O/c1-3-4(2)6-5;1-3-4(2)5/h4-5H,3H2,1-2H3;3H2,1-2H3 |
| InChIKey | ZLWHPYHSRCECBJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze butan-2-one;2-hydroperoxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;2-hydroperoxybutane?
The IUPAC name of butan-2-one;2-hydroperoxybutane (CID 162156312) is butan-2-one;2-hydroperoxybutane.
What is the SMILES notation for butan-2-one;2-hydroperoxybutane?
The canonical SMILES for butan-2-one;2-hydroperoxybutane is CCC(C)=O.CCC(C)OO.
What is the InChIKey of butan-2-one;2-hydroperoxybutane?
The InChIKey is ZLWHPYHSRCECBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2.C4H8O/c1-3-4(2)6-5;1-3-4(2)5/h4-5H,3H2,1-2H3;3H2,1-2H3.
What are the key properties of butan-2-one;2-hydroperoxybutane?
butan-2-one;2-hydroperoxybutane has a molecular weight of 162.23 g/mol, XLogP of 2.26, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;2-hydroperoxybutane is sourced from PubChem (CID 162156312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).