About di(butan-2-yloxy)alumane;pentane-2,4-dione
di(butan-2-yloxy)alumane;pentane-2,4-dione (PubChem CID 175346513) has the molecular formula C13H27AlO4
and a molecular weight of 274.34 g/mol. Its IUPAC name is di(butan-2-yloxy)alumane;pentane-2,4-dione.
Molecular Properties
| Compound Name | di(butan-2-yloxy)alumane;pentane-2,4-dione |
| PubChem CID | 175346513 |
| Molecular Formula | C13H27AlO4 |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | di(butan-2-yloxy)alumane;pentane-2,4-dione |
| SMILES | CC(=O)CC(C)=O.CCC(C)O[AlH]OC(C)CC |
| InChI | InChI=1S/C5H8O2.2C4H9O.Al.H/c1-4(6)3-5(2)7;2*1-3-4(2)5;;/h3H2,1-2H3;2*4H,3H2,1-2H3;;/q;2*-1;+2; |
| InChIKey | MBCMSYRFSJTYHH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze di(butan-2-yloxy)alumane;pentane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(butan-2-yloxy)alumane;pentane-2,4-dione?
The IUPAC name of di(butan-2-yloxy)alumane;pentane-2,4-dione (CID 175346513) is di(butan-2-yloxy)alumane;pentane-2,4-dione.
What is the SMILES notation for di(butan-2-yloxy)alumane;pentane-2,4-dione?
The canonical SMILES for di(butan-2-yloxy)alumane;pentane-2,4-dione is CC(=O)CC(C)=O.CCC(C)O[AlH]OC(C)CC.
What is the InChIKey of di(butan-2-yloxy)alumane;pentane-2,4-dione?
The InChIKey is MBCMSYRFSJTYHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.2C4H9O.Al.H/c1-4(6)3-5(2)7;2*1-3-4(2)5;;/h3H2,1-2H3;2*4H,3H2,1-2H3;;/q;2*-1;+2;.
What are the key properties of di(butan-2-yloxy)alumane;pentane-2,4-dione?
di(butan-2-yloxy)alumane;pentane-2,4-dione has a molecular weight of 274.34 g/mol, XLogP of 2.44, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for di(butan-2-yloxy)alumane;pentane-2,4-dione is sourced from PubChem (CID 175346513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).