About bis(butan-2-yl 3-oxobutaneperoxoate);titanium
bis(butan-2-yl 3-oxobutaneperoxoate);titanium (PubChem CID 159822417) has the molecular formula C16H28O8Ti
and a molecular weight of 396.26 g/mol. Its IUPAC name is bis(butan-2-yl 3-oxobutaneperoxoate);titanium.
Molecular Properties
| Compound Name | bis(butan-2-yl 3-oxobutaneperoxoate);titanium |
| PubChem CID | 159822417 |
| Molecular Formula | C16H28O8Ti |
| Molecular Weight | 396.26 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | bis(butan-2-yl 3-oxobutaneperoxoate);titanium |
| SMILES | CCC(C)OOC(=O)CC(C)=O.CCC(C)OOC(=O)CC(C)=O.[Ti] |
| InChI | InChI=1S/2C8H14O4.Ti/c2*1-4-7(3)11-12-8(10)5-6(2)9;/h2*7H,4-5H2,1-3H3; |
| InChIKey | NMKISLMDLHZKFV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze bis(butan-2-yl 3-oxobutaneperoxoate);titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(butan-2-yl 3-oxobutaneperoxoate);titanium?
The IUPAC name of bis(butan-2-yl 3-oxobutaneperoxoate);titanium (CID 159822417) is bis(butan-2-yl 3-oxobutaneperoxoate);titanium.
What is the SMILES notation for bis(butan-2-yl 3-oxobutaneperoxoate);titanium?
The canonical SMILES for bis(butan-2-yl 3-oxobutaneperoxoate);titanium is CCC(C)OOC(=O)CC(C)=O.CCC(C)OOC(=O)CC(C)=O.[Ti].
What is the InChIKey of bis(butan-2-yl 3-oxobutaneperoxoate);titanium?
The InChIKey is NMKISLMDLHZKFV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H14O4.Ti/c2*1-4-7(3)11-12-8(10)5-6(2)9;/h2*7H,4-5H2,1-3H3;.
What are the key properties of bis(butan-2-yl 3-oxobutaneperoxoate);titanium?
bis(butan-2-yl 3-oxobutaneperoxoate);titanium has a molecular weight of 396.26 g/mol, XLogP of 2.48, 10 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(butan-2-yl 3-oxobutaneperoxoate);titanium is sourced from PubChem (CID 159822417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).