About (4Z,6E)-8-hydroperoxyundeca-4,6-diene
(4Z,6E)-8-hydroperoxyundeca-4,6-diene (PubChem CID 11286867) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is (4Z,6E)-8-hydroperoxyundeca-4,6-diene.
Molecular Properties
| Compound Name | (4Z,6E)-8-hydroperoxyundeca-4,6-diene |
| PubChem CID | 11286867 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (4Z,6E)-8-hydroperoxyundeca-4,6-diene |
| SMILES | CCC/C=C\C=C\C(CCC)OO |
| InChI | InChI=1S/C11H20O2/c1-3-5-6-7-8-10-11(13-12)9-4-2/h6-8,10-12H,3-5,9H2,1-2H3/b7-6-,10-8+ |
| InChIKey | LNZVWLFVVADVHL-VAAURPRASA-N |
| XLogP | 3.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z,6E)-8-hydroperoxyundeca-4,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z,6E)-8-hydroperoxyundeca-4,6-diene?
The IUPAC name of (4Z,6E)-8-hydroperoxyundeca-4,6-diene (CID 11286867) is (4Z,6E)-8-hydroperoxyundeca-4,6-diene.
What is the SMILES notation for (4Z,6E)-8-hydroperoxyundeca-4,6-diene?
The canonical SMILES for (4Z,6E)-8-hydroperoxyundeca-4,6-diene is CCC/C=C\C=C\C(CCC)OO.
What is the InChIKey of (4Z,6E)-8-hydroperoxyundeca-4,6-diene?
The InChIKey is LNZVWLFVVADVHL-VAAURPRASA-N. The full InChI is InChI=1S/C11H20O2/c1-3-5-6-7-8-10-11(13-12)9-4-2/h6-8,10-12H,3-5,9H2,1-2H3/b7-6-,10-8+.
What are the key properties of (4Z,6E)-8-hydroperoxyundeca-4,6-diene?
(4Z,6E)-8-hydroperoxyundeca-4,6-diene has a molecular weight of 184.28 g/mol, XLogP of 3.56, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z,6E)-8-hydroperoxyundeca-4,6-diene is sourced from PubChem (CID 11286867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).