C11H22NO8P — CID 159836230
2-[2-aminoethoxy(hydroxy)phosphoryl]oxyethyl 5-hydroperoxyhept-3-enoate (PubChem CID 159836230) has the molecular formula C11H22NO8P and a molecular weight of 327.27 g/mol. Its IUPAC name is 2-[2-aminoethoxy(hydroxy)phosphoryl]oxyethyl 5-hydroperoxyhept-3-enoate.
| Compound Name | 2-[2-aminoethoxy(hydroxy)phosphoryl]oxyethyl 5-hydroperoxyhept-3-enoate |
|---|---|
| PubChem CID | 159836230 |
| Molecular Formula | C11H22NO8P |
| Molecular Weight | 327.27 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 2-[2-aminoethoxy(hydroxy)phosphoryl]oxyethyl 5-hydroperoxyhept-3-enoate |
| SMILES | CCC(C=CCC(=O)OCCOP(=O)(O)OCCN)OO |
| InChI | InChI=1S/C11H22NO8P/c1-2-10(20-14)4-3-5-11(13)17-8-9-19-21(15,16)18-7-6-12/h3-4,10,14H,2,5-9,12H2,1H3,(H,15,16) |
| InChIKey | CXFBUDREDNANSU-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 137.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|