C8H18NO6P — CID 126647188
2-[2-aminoethoxy(hydroxy)phosphoryl]oxyethyl 2-methylpropanoate (PubChem CID 126647188) has the molecular formula C8H18NO6P and a molecular weight of 255.21 g/mol. Its IUPAC name is 2-[2-aminoethoxy(hydroxy)phosphoryl]oxyethyl 2-methylpropanoate.
| Compound Name | 2-[2-aminoethoxy(hydroxy)phosphoryl]oxyethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 126647188 |
| Molecular Formula | C8H18NO6P |
| Molecular Weight | 255.21 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 2-[2-aminoethoxy(hydroxy)phosphoryl]oxyethyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCCOP(=O)(O)OCCN |
| InChI | InChI=1S/C8H18NO6P/c1-7(2)8(10)13-5-6-15-16(11,12)14-4-3-9/h7H,3-6,9H2,1-2H3,(H,11,12) |
| InChIKey | BSBZZYVKSSAPNR-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.21 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|