C13H30N2O6PS+ — CID 57386108
2-[2-[3-(2-aminoethylsulfanyl)-2-methylpropanoyl]oxyethoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 57386108) has the molecular formula C13H30N2O6PS+ and a molecular weight of 373.43 g/mol. Its IUPAC name is 2-[2-[3-(2-aminoethylsulfanyl)-2-methylpropanoyl]oxyethoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[2-[3-(2-aminoethylsulfanyl)-2-methylpropanoyl]oxyethoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 57386108 |
| Molecular Formula | C13H30N2O6PS+ |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 2-[2-[3-(2-aminoethylsulfanyl)-2-methylpropanoyl]oxyethoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CC(CSCCN)C(=O)OCCOP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C13H29N2O6PS/c1-12(11-23-10-5-14)13(16)19-8-9-21-22(17,18)20-7-6-15(2,3)4/h12H,5-11,14H2,1-4H3/p+1 |
| InChIKey | RNMWYAAPWVCJCP-UHFFFAOYSA-O |
| XLogP | 0.70 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|