C20H42N2O6P+ — CID 159265327
2-[2-[2-ethyl-2,4-dimethyl-5-(propan-2-ylamino)hex-5-enoyl]oxyethoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 159265327) has the molecular formula C20H42N2O6P+ and a molecular weight of 437.54 g/mol. Its IUPAC name is 2-[2-[2-ethyl-2,4-dimethyl-5-(propan-2-ylamino)hex-5-enoyl]oxyethoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[2-[2-ethyl-2,4-dimethyl-5-(propan-2-ylamino)hex-5-enoyl]oxyethoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 159265327 |
| Molecular Formula | C20H42N2O6P+ |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | 2-[2-[2-ethyl-2,4-dimethyl-5-(propan-2-ylamino)hex-5-enoyl]oxyethoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | C=C(NC(C)C)C(C)CC(C)(CC)C(=O)OCCOP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C20H41N2O6P/c1-10-20(6,15-17(4)18(5)21-16(2)3)19(23)26-13-14-28-29(24,25)27-12-11-22(7,8)9/h16-17,21H,5,10-15H2,1-4,6-9H3/p+1 |
| InChIKey | KXAHGEIOJWAXFA-UHFFFAOYSA-O |
| XLogP | 3.32 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|